C9H9Cl3O — CID 53356260
(2S,3R)-2,3-dichloro-3-(4-chlorophenyl)propan-1-ol (PubChem CID 53356260) has the molecular formula C9H9Cl3O and a molecular weight of 239.53 g/mol. Its IUPAC name is (2S,3R)-2,3-dichloro-3-(4-chlorophenyl)propan-1-ol.
| Compound Name | (2S,3R)-2,3-dichloro-3-(4-chlorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 53356260 |
| Molecular Formula | C9H9Cl3O |
| Molecular Weight | 239.53 g/mol |
| Exact Mass | 237.97 |
| IUPAC Name | (2S,3R)-2,3-dichloro-3-(4-chlorophenyl)propan-1-ol |
| SMILES | OC[C@H](Cl)[C@H](Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H9Cl3O/c10-7-3-1-6(2-4-7)9(12)8(11)5-13/h1-4,8-9,13H,5H2/t8-,9+/m0/s1 |
| InChIKey | QHGBOXGEEPYKSL-DTWKUNHWSA-N |
| XLogP | 3.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.53 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|