C10H13ClO2 — CID 122579159
(1S,2R)-1-(4-chlorophenyl)-2-methylpropane-1,3-diol (PubChem CID 122579159) has the molecular formula C10H13ClO2 and a molecular weight of 200.66 g/mol. Its IUPAC name is (1S,2R)-1-(4-chlorophenyl)-2-methylpropane-1,3-diol.
| Compound Name | (1S,2R)-1-(4-chlorophenyl)-2-methylpropane-1,3-diol |
|---|---|
| PubChem CID | 122579159 |
| Molecular Formula | C10H13ClO2 |
| Molecular Weight | 200.66 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | (1S,2R)-1-(4-chlorophenyl)-2-methylpropane-1,3-diol |
| SMILES | C[C@H](CO)[C@H](O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H13ClO2/c1-7(6-12)10(13)8-2-4-9(11)5-3-8/h2-5,7,10,12-13H,6H2,1H3/t7-,10+/m1/s1 |
| InChIKey | BCCTWIMRPPTOKU-XCBNKYQSSA-N |
| XLogP | 2.00 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.66 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |