C21H22N2O2S — CID 8775706
(6,7-dimethyl-2-oxochromen-4-yl)methyl N'-[(1S)-1-phenylethyl]carbamimidothioate (PubChem CID 8775706) has the molecular formula C21H22N2O2S and a molecular weight of 366.49 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl N'-[(1S)-1-phenylethyl]carbamimidothioate.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl N'-[(1S)-1-phenylethyl]carbamimidothioate |
|---|---|
| PubChem CID | 8775706 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl N'-[(1S)-1-phenylethyl]carbamimidothioate |
| SMILES | Cc1cc2oc(=O)cc(CS/C(N)=N/[C@@H](C)c3ccccc3)c2cc1C |
| InChI | InChI=1S/C21H22N2O2S/c1-13-9-18-17(11-20(24)25-19(18)10-14(13)2)12-26-21(22)23-15(3)16-7-5-4-6-8-16/h4-11,15H,12H2,1-3H3,(H2,22,23)/t15-/m0/s1 |
| InChIKey | SNVISNHVDIVRQQ-HNNXBMFYSA-N |
| XLogP | 4.72 |
| TPSA | 68.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|