C27H29ClN2O3S — CID 3988678
7-chloro-3-(3-methylbutyl)-2-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methylsulfanyl]quinazolin-4-one (PubChem CID 3988678) has the molecular formula C27H29ClN2O3S and a molecular weight of 497.06 g/mol. Its IUPAC name is 7-chloro-3-(3-methylbutyl)-2-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methylsulfanyl]quinazolin-4-one.
| Compound Name | 7-chloro-3-(3-methylbutyl)-2-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 3988678 |
| Molecular Formula | C27H29ClN2O3S |
| Molecular Weight | 497.06 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | 7-chloro-3-(3-methylbutyl)-2-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methylsulfanyl]quinazolin-4-one |
| SMILES | Cc1cc2oc(=O)cc(CSc3nc4cc(Cl)ccc4c(=O)n3CCC(C)C)c2cc1C(C)C |
| InChI | InChI=1S/C27H29ClN2O3S/c1-15(2)8-9-30-26(32)20-7-6-19(28)12-23(20)29-27(30)34-14-18-11-25(31)33-24-10-17(5)21(16(3)4)13-22(18)24/h6-7,10-13,15-16H,8-9,14H2,1-5H3 |
| InChIKey | DYGRDJYNFOIDPP-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.06 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|