C20H16BrN3O3S — CID 31719849
7-bromo-4-[[5-(4-methoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]chromen-2-one (PubChem CID 31719849) has the molecular formula C20H16BrN3O3S and a molecular weight of 458.34 g/mol. Its IUPAC name is 7-bromo-4-[[5-(4-methoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]chromen-2-one.
| Compound Name | 7-bromo-4-[[5-(4-methoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]chromen-2-one |
|---|---|
| PubChem CID | 31719849 |
| Molecular Formula | C20H16BrN3O3S |
| Molecular Weight | 458.34 g/mol |
| Exact Mass | 457.01 |
| IUPAC Name | 7-bromo-4-[[5-(4-methoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]chromen-2-one |
| SMILES | COc1ccc(-c2nnc(SCc3cc(=O)oc4cc(Br)ccc34)n2C)cc1 |
| InChI | InChI=1S/C20H16BrN3O3S/c1-24-19(12-3-6-15(26-2)7-4-12)22-23-20(24)28-11-13-9-18(25)27-17-10-14(21)5-8-16(13)17/h3-10H,11H2,1-2H3 |
| InChIKey | JSYATWFJYCRYEA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.34 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|