C21H17ClFN3O2S — CID 112784951
6-chloro-7-ethyl-4-[[5-(4-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]chromen-2-one (PubChem CID 112784951) has the molecular formula C21H17ClFN3O2S and a molecular weight of 429.90 g/mol. Its IUPAC name is 6-chloro-7-ethyl-4-[[5-(4-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]chromen-2-one.
| Compound Name | 6-chloro-7-ethyl-4-[[5-(4-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]chromen-2-one |
|---|---|
| PubChem CID | 112784951 |
| Molecular Formula | C21H17ClFN3O2S |
| Molecular Weight | 429.90 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 6-chloro-7-ethyl-4-[[5-(4-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]chromen-2-one |
| SMILES | CCc1cc2oc(=O)cc(CSc3nnc(-c4ccc(F)cc4)n3C)c2cc1Cl |
| InChI | InChI=1S/C21H17ClFN3O2S/c1-3-12-8-18-16(10-17(12)22)14(9-19(27)28-18)11-29-21-25-24-20(26(21)2)13-4-6-15(23)7-5-13/h4-10H,3,11H2,1-2H3 |
| InChIKey | HGGHOTIFZPLWIP-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.90 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|