C15H13ClN2O2S2 — CID 52531996
6-chloro-7-ethyl-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]chromen-2-one (PubChem CID 52531996) has the molecular formula C15H13ClN2O2S2 and a molecular weight of 352.87 g/mol. Its IUPAC name is 6-chloro-7-ethyl-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]chromen-2-one.
| Compound Name | 6-chloro-7-ethyl-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]chromen-2-one |
|---|---|
| PubChem CID | 52531996 |
| Molecular Formula | C15H13ClN2O2S2 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 6-chloro-7-ethyl-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]chromen-2-one |
| SMILES | CCc1cc2oc(=O)cc(CSc3nnc(C)s3)c2cc1Cl |
| InChI | InChI=1S/C15H13ClN2O2S2/c1-3-9-4-13-11(6-12(9)16)10(5-14(19)20-13)7-21-15-18-17-8(2)22-15/h4-6H,3,7H2,1-2H3 |
| InChIKey | GLGXMLRMCKLYAR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|