C21H23ClN2O4S2 — CID 46814882
6-[(6-chloro-7-ethyl-2-oxochromen-4-yl)methylsulfanyl]-N,N-diethylpyridine-3-sulfonamide (PubChem CID 46814882) has the molecular formula C21H23ClN2O4S2 and a molecular weight of 467.01 g/mol. Its IUPAC name is 6-[(6-chloro-7-ethyl-2-oxochromen-4-yl)methylsulfanyl]-N,N-diethylpyridine-3-sulfonamide.
| Compound Name | 6-[(6-chloro-7-ethyl-2-oxochromen-4-yl)methylsulfanyl]-N,N-diethylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 46814882 |
| Molecular Formula | C21H23ClN2O4S2 |
| Molecular Weight | 467.01 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | 6-[(6-chloro-7-ethyl-2-oxochromen-4-yl)methylsulfanyl]-N,N-diethylpyridine-3-sulfonamide |
| SMILES | CCc1cc2oc(=O)cc(CSc3ccc(S(=O)(=O)N(CC)CC)cn3)c2cc1Cl |
| InChI | InChI=1S/C21H23ClN2O4S2/c1-4-14-9-19-17(11-18(14)22)15(10-21(25)28-19)13-29-20-8-7-16(12-23-20)30(26,27)24(5-2)6-3/h7-12H,4-6,13H2,1-3H3 |
| InChIKey | VTWKMSBXFOYFDT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 80.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.01 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|