C16H19ClN2O2S2 — CID 40663670
6-[(2-chlorophenyl)methylsulfanyl]-N,N-diethylpyridine-3-sulfonamide (PubChem CID 40663670) has the molecular formula C16H19ClN2O2S2 and a molecular weight of 370.93 g/mol. Its IUPAC name is 6-[(2-chlorophenyl)methylsulfanyl]-N,N-diethylpyridine-3-sulfonamide.
| Compound Name | 6-[(2-chlorophenyl)methylsulfanyl]-N,N-diethylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 40663670 |
| Molecular Formula | C16H19ClN2O2S2 |
| Molecular Weight | 370.93 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 6-[(2-chlorophenyl)methylsulfanyl]-N,N-diethylpyridine-3-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(SCc2ccccc2Cl)nc1 |
| InChI | InChI=1S/C16H19ClN2O2S2/c1-3-19(4-2)23(20,21)14-9-10-16(18-11-14)22-12-13-7-5-6-8-15(13)17/h5-11H,3-4,12H2,1-2H3 |
| InChIKey | LIDFWTNYDKFUPE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.93 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |