C16H17ClN2O3S2 — CID 17390596
4-[[6-[(2-chlorophenyl)methylsulfanyl]-3-pyridinyl]sulfonyl]morpholine (PubChem CID 17390596) has the molecular formula C16H17ClN2O3S2 and a molecular weight of 384.91 g/mol. Its IUPAC name is 4-[[6-[(2-chlorophenyl)methylsulfanyl]-3-pyridinyl]sulfonyl]morpholine.
| Compound Name | 4-[[6-[(2-chlorophenyl)methylsulfanyl]-3-pyridinyl]sulfonyl]morpholine |
|---|---|
| PubChem CID | 17390596 |
| Molecular Formula | C16H17ClN2O3S2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 4-[[6-[(2-chlorophenyl)methylsulfanyl]-3-pyridinyl]sulfonyl]morpholine |
| SMILES | O=S(=O)(c1ccc(SCc2ccccc2Cl)nc1)N1CCOCC1 |
| InChI | InChI=1S/C16H17ClN2O3S2/c17-15-4-2-1-3-13(15)12-23-16-6-5-14(11-18-16)24(20,21)19-7-9-22-10-8-19/h1-6,11H,7-10,12H2 |
| InChIKey | ZWYFCMNBOIZPRT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |