C17H19ClN2O2S2 — CID 7759312
2-[(4-chlorophenyl)methylsulfanyl]-5-piperidin-1-ylsulfonylpyridine (PubChem CID 7759312) has the molecular formula C17H19ClN2O2S2 and a molecular weight of 382.94 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfanyl]-5-piperidin-1-ylsulfonylpyridine.
| Compound Name | 2-[(4-chlorophenyl)methylsulfanyl]-5-piperidin-1-ylsulfonylpyridine |
|---|---|
| PubChem CID | 7759312 |
| Molecular Formula | C17H19ClN2O2S2 |
| Molecular Weight | 382.94 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfanyl]-5-piperidin-1-ylsulfonylpyridine |
| SMILES | O=S(=O)(c1ccc(SCc2ccc(Cl)cc2)nc1)N1CCCCC1 |
| InChI | InChI=1S/C17H19ClN2O2S2/c18-15-6-4-14(5-7-15)13-23-17-9-8-16(12-19-17)24(21,22)20-10-2-1-3-11-20/h4-9,12H,1-3,10-11,13H2 |
| InChIKey | DYNQXLAQGNPDJM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.94 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |