C17H19ClN2O2S3 — CID 7603003
2-[2-(4-chlorophenyl)sulfanylethylsulfanyl]-5-pyrrolidin-1-ylsulfonylpyridine (PubChem CID 7603003) has the molecular formula C17H19ClN2O2S3 and a molecular weight of 415.01 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)sulfanylethylsulfanyl]-5-pyrrolidin-1-ylsulfonylpyridine.
| Compound Name | 2-[2-(4-chlorophenyl)sulfanylethylsulfanyl]-5-pyrrolidin-1-ylsulfonylpyridine |
|---|---|
| PubChem CID | 7603003 |
| Molecular Formula | C17H19ClN2O2S3 |
| Molecular Weight | 415.01 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | 2-[2-(4-chlorophenyl)sulfanylethylsulfanyl]-5-pyrrolidin-1-ylsulfonylpyridine |
| SMILES | O=S(=O)(c1ccc(SCCSc2ccc(Cl)cc2)nc1)N1CCCC1 |
| InChI | InChI=1S/C17H19ClN2O2S3/c18-14-3-5-15(6-4-14)23-11-12-24-17-8-7-16(13-19-17)25(21,22)20-9-1-2-10-20/h3-8,13H,1-2,9-12H2 |
| InChIKey | JHIGWDFCQPVNPI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.01 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|