C18H22N2O2S3 — CID 7561735
2-[(4-methylsulfanylphenyl)methylsulfanyl]-5-piperidin-1-ylsulfonylpyridine (PubChem CID 7561735) has the molecular formula C18H22N2O2S3 and a molecular weight of 394.59 g/mol. Its IUPAC name is 2-[(4-methylsulfanylphenyl)methylsulfanyl]-5-piperidin-1-ylsulfonylpyridine.
| Compound Name | 2-[(4-methylsulfanylphenyl)methylsulfanyl]-5-piperidin-1-ylsulfonylpyridine |
|---|---|
| PubChem CID | 7561735 |
| Molecular Formula | C18H22N2O2S3 |
| Molecular Weight | 394.59 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 2-[(4-methylsulfanylphenyl)methylsulfanyl]-5-piperidin-1-ylsulfonylpyridine |
| SMILES | CSc1ccc(CSc2ccc(S(=O)(=O)N3CCCCC3)cn2)cc1 |
| InChI | InChI=1S/C18H22N2O2S3/c1-23-16-7-5-15(6-8-16)14-24-18-10-9-17(13-19-18)25(21,22)20-11-3-2-4-12-20/h5-10,13H,2-4,11-12,14H2,1H3 |
| InChIKey | SOVXRCMLLQWCST-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.59 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |