C16H16ClFN2O2S2 — CID 7594028
2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-5-pyrrolidin-1-ylsulfonylpyridine (PubChem CID 7594028) has the molecular formula C16H16ClFN2O2S2 and a molecular weight of 386.90 g/mol. Its IUPAC name is 2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-5-pyrrolidin-1-ylsulfonylpyridine.
| Compound Name | 2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-5-pyrrolidin-1-ylsulfonylpyridine |
|---|---|
| PubChem CID | 7594028 |
| Molecular Formula | C16H16ClFN2O2S2 |
| Molecular Weight | 386.90 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | 2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-5-pyrrolidin-1-ylsulfonylpyridine |
| SMILES | O=S(=O)(c1ccc(SCc2c(F)cccc2Cl)nc1)N1CCCC1 |
| InChI | InChI=1S/C16H16ClFN2O2S2/c17-14-4-3-5-15(18)13(14)11-23-16-7-6-12(10-19-16)24(21,22)20-8-1-2-9-20/h3-7,10H,1-2,8-9,11H2 |
| InChIKey | XOHPNRGIIJDJEG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.90 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |