C18H20F2N2O3S2 — CID 60561377
2-[[4-(difluoromethoxy)phenyl]methylsulfanyl]-5-piperidin-1-ylsulfonylpyridine (PubChem CID 60561377) has the molecular formula C18H20F2N2O3S2 and a molecular weight of 414.50 g/mol. Its IUPAC name is 2-[[4-(difluoromethoxy)phenyl]methylsulfanyl]-5-piperidin-1-ylsulfonylpyridine.
| Compound Name | 2-[[4-(difluoromethoxy)phenyl]methylsulfanyl]-5-piperidin-1-ylsulfonylpyridine |
|---|---|
| PubChem CID | 60561377 |
| Molecular Formula | C18H20F2N2O3S2 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 2-[[4-(difluoromethoxy)phenyl]methylsulfanyl]-5-piperidin-1-ylsulfonylpyridine |
| SMILES | O=S(=O)(c1ccc(SCc2ccc(OC(F)F)cc2)nc1)N1CCCCC1 |
| InChI | InChI=1S/C18H20F2N2O3S2/c19-18(20)25-15-6-4-14(5-7-15)13-26-17-9-8-16(12-21-17)27(23,24)22-10-2-1-3-11-22/h4-9,12,18H,1-3,10-11,13H2 |
| InChIKey | BCKMBFAXICEFLR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |