C17H19ClN2O3S2 — CID 7774902
4-[[6-[(1S)-1-(2-chlorophenyl)ethyl]sulfanyl-3-pyridinyl]sulfonyl]morpholine (PubChem CID 7774902) has the molecular formula C17H19ClN2O3S2 and a molecular weight of 398.94 g/mol. Its IUPAC name is 4-[[6-[(1S)-1-(2-chlorophenyl)ethyl]sulfanyl-3-pyridinyl]sulfonyl]morpholine.
| Compound Name | 4-[[6-[(1S)-1-(2-chlorophenyl)ethyl]sulfanyl-3-pyridinyl]sulfonyl]morpholine |
|---|---|
| PubChem CID | 7774902 |
| Molecular Formula | C17H19ClN2O3S2 |
| Molecular Weight | 398.94 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 4-[[6-[(1S)-1-(2-chlorophenyl)ethyl]sulfanyl-3-pyridinyl]sulfonyl]morpholine |
| SMILES | C[C@H](Sc1ccc(S(=O)(=O)N2CCOCC2)cn1)c1ccccc1Cl |
| InChI | InChI=1S/C17H19ClN2O3S2/c1-13(15-4-2-3-5-16(15)18)24-17-7-6-14(12-19-17)25(21,22)20-8-10-23-11-9-20/h2-7,12-13H,8-11H2,1H3/t13-/m0/s1 |
| InChIKey | LXIUZOJAQUOPMP-ZDUSSCGKSA-N |
| XLogP | 3.61 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.94 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |