C14H20N2O5S2 — CID 52511353
ethyl (2S)-2-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)sulfanyl]propanoate (PubChem CID 52511353) has the molecular formula C14H20N2O5S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is ethyl (2S)-2-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)sulfanyl]propanoate.
| Compound Name | ethyl (2S)-2-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)sulfanyl]propanoate |
|---|---|
| PubChem CID | 52511353 |
| Molecular Formula | C14H20N2O5S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | ethyl (2S)-2-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)sulfanyl]propanoate |
| SMILES | CCOC(=O)[C@H](C)Sc1ccc(S(=O)(=O)N2CCOCC2)cn1 |
| InChI | InChI=1S/C14H20N2O5S2/c1-3-21-14(17)11(2)22-13-5-4-12(10-15-13)23(18,19)16-6-8-20-9-7-16/h4-5,10-11H,3,6-9H2,1-2H3/t11-/m0/s1 |
| InChIKey | NVQVKKXOLNRLPX-NSHDSACASA-N |
| XLogP | 1.15 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |