C18H19FN2O4S2 — CID 38974194
(2S)-1-(4-fluorophenyl)-2-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)sulfanyl]propan-1-one (PubChem CID 38974194) has the molecular formula C18H19FN2O4S2 and a molecular weight of 410.49 g/mol. Its IUPAC name is (2S)-1-(4-fluorophenyl)-2-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)sulfanyl]propan-1-one.
| Compound Name | (2S)-1-(4-fluorophenyl)-2-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)sulfanyl]propan-1-one |
|---|---|
| PubChem CID | 38974194 |
| Molecular Formula | C18H19FN2O4S2 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | (2S)-1-(4-fluorophenyl)-2-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)sulfanyl]propan-1-one |
| SMILES | C[C@H](Sc1ccc(S(=O)(=O)N2CCOCC2)cn1)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H19FN2O4S2/c1-13(18(22)14-2-4-15(19)5-3-14)26-17-7-6-16(12-20-17)27(23,24)21-8-10-25-11-9-21/h2-7,12-13H,8-11H2,1H3/t13-/m0/s1 |
| InChIKey | ZXBVDBXCCMUUJK-ZDUSSCGKSA-N |
| XLogP | 2.61 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |