C19H21ClN2O3S2 — CID 38969397
(2S)-1-(3-chlorophenyl)-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]propan-1-one (PubChem CID 38969397) has the molecular formula C19H21ClN2O3S2 and a molecular weight of 424.98 g/mol. Its IUPAC name is (2S)-1-(3-chlorophenyl)-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]propan-1-one.
| Compound Name | (2S)-1-(3-chlorophenyl)-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]propan-1-one |
|---|---|
| PubChem CID | 38969397 |
| Molecular Formula | C19H21ClN2O3S2 |
| Molecular Weight | 424.98 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | (2S)-1-(3-chlorophenyl)-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]propan-1-one |
| SMILES | C[C@H](Sc1ccc(S(=O)(=O)N2CCCCC2)cn1)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H21ClN2O3S2/c1-14(19(23)15-6-5-7-16(20)12-15)26-18-9-8-17(13-21-18)27(24,25)22-10-3-2-4-11-22/h5-9,12-14H,2-4,10-11H2,1H3/t14-/m0/s1 |
| InChIKey | UIACRTMNLRMBBO-AWEZNQCLSA-N |
| XLogP | 4.27 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.98 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |