C25H27N3O4S2 — CID 40919685
(2R)-N-benzhydryl-2-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)sulfanyl]propanamide (PubChem CID 40919685) has the molecular formula C25H27N3O4S2 and a molecular weight of 497.64 g/mol. Its IUPAC name is (2R)-N-benzhydryl-2-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)sulfanyl]propanamide.
| Compound Name | (2R)-N-benzhydryl-2-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 40919685 |
| Molecular Formula | C25H27N3O4S2 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | (2R)-N-benzhydryl-2-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)sulfanyl]propanamide |
| SMILES | C[C@@H](Sc1ccc(S(=O)(=O)N2CCOCC2)cn1)C(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H27N3O4S2/c1-19(25(29)27-24(20-8-4-2-5-9-20)21-10-6-3-7-11-21)33-23-13-12-22(18-26-23)34(30,31)28-14-16-32-17-15-28/h2-13,18-19,24H,14-17H2,1H3,(H,27,29)/t19-/m1/s1 |
| InChIKey | YIOYRIXWABSRQI-LJQANCHMSA-N |
| XLogP | 3.49 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |