C17H25N3O4S2 — CID 7569990
1-(azepan-1-yl)-2-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)sulfanyl]ethanone (PubChem CID 7569990) has the molecular formula C17H25N3O4S2 and a molecular weight of 399.54 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)sulfanyl]ethanone.
| Compound Name | 1-(azepan-1-yl)-2-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 7569990 |
| Molecular Formula | C17H25N3O4S2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 1-(azepan-1-yl)-2-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)sulfanyl]ethanone |
| SMILES | O=C(CSc1ccc(S(=O)(=O)N2CCOCC2)cn1)N1CCCCCC1 |
| InChI | InChI=1S/C17H25N3O4S2/c21-17(19-7-3-1-2-4-8-19)14-25-16-6-5-15(13-18-16)26(22,23)20-9-11-24-12-10-20/h5-6,13H,1-4,7-12,14H2 |
| InChIKey | IXVRUIMULBDLCF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |