C16H23N3O5S2 — CID 24578006
1-(2-methylmorpholin-4-yl)-2-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)sulfanyl]ethanone (PubChem CID 24578006) has the molecular formula C16H23N3O5S2 and a molecular weight of 401.51 g/mol. Its IUPAC name is 1-(2-methylmorpholin-4-yl)-2-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)sulfanyl]ethanone.
| Compound Name | 1-(2-methylmorpholin-4-yl)-2-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 24578006 |
| Molecular Formula | C16H23N3O5S2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 1-(2-methylmorpholin-4-yl)-2-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)sulfanyl]ethanone |
| SMILES | CC1CN(C(=O)CSc2ccc(S(=O)(=O)N3CCOCC3)cn2)CCO1 |
| InChI | InChI=1S/C16H23N3O5S2/c1-13-11-18(4-9-24-13)16(20)12-25-15-3-2-14(10-17-15)26(21,22)19-5-7-23-8-6-19/h2-3,10,13H,4-9,11-12H2,1H3 |
| InChIKey | SJJBUAUHPHWBKK-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |