C16H17N3O3S — CID 2576488
3-[(7-methyl-2-oxochromen-4-yl)methylsulfanyl]-4-propyl-1H-1,2,4-triazol-5-one (PubChem CID 2576488) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is 3-[(7-methyl-2-oxochromen-4-yl)methylsulfanyl]-4-propyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-[(7-methyl-2-oxochromen-4-yl)methylsulfanyl]-4-propyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 2576488 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 3-[(7-methyl-2-oxochromen-4-yl)methylsulfanyl]-4-propyl-1H-1,2,4-triazol-5-one |
| SMILES | CCCn1c(SCc2cc(=O)oc3cc(C)ccc23)n[nH]c1=O |
| InChI | InChI=1S/C16H17N3O3S/c1-3-6-19-15(21)17-18-16(19)23-9-11-8-14(20)22-13-7-10(2)4-5-12(11)13/h4-5,7-8H,3,6,9H2,1-2H3,(H,17,21) |
| InChIKey | NLIJAIOLULECGO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|