C22H23N2O2S+ — CID 9048075
[(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-[(7-ethyl-2-oxochromen-4-yl)methyl]-methylazanium (PubChem CID 9048075) has the molecular formula C22H23N2O2S+ and a molecular weight of 379.51 g/mol. Its IUPAC name is [(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-[(7-ethyl-2-oxochromen-4-yl)methyl]-methylazanium.
| Compound Name | [(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-[(7-ethyl-2-oxochromen-4-yl)methyl]-methylazanium |
|---|---|
| PubChem CID | 9048075 |
| Molecular Formula | C22H23N2O2S+ |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | [(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-[(7-ethyl-2-oxochromen-4-yl)methyl]-methylazanium |
| SMILES | CCc1ccc2c(C[NH+](C)[C@@H](C)c3nc4ccccc4s3)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H22N2O2S/c1-4-15-9-10-17-16(12-21(25)26-19(17)11-15)13-24(3)14(2)22-23-18-7-5-6-8-20(18)27-22/h5-12,14H,4,13H2,1-3H3/p+1/t14-/m0/s1 |
| InChIKey | GZCFUPWSHOSYOL-AWEZNQCLSA-O |
| XLogP | 3.74 |
| TPSA | 47.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|