C18H20NO4+ — CID 9332772
(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl-(furan-2-ylmethyl)-methylazanium (PubChem CID 9332772) has the molecular formula C18H20NO4+ and a molecular weight of 314.36 g/mol. Its IUPAC name is (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl-(furan-2-ylmethyl)-methylazanium.
| Compound Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl-(furan-2-ylmethyl)-methylazanium |
|---|---|
| PubChem CID | 9332772 |
| Molecular Formula | C18H20NO4+ |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl-(furan-2-ylmethyl)-methylazanium |
| SMILES | CCc1cc2c(C[NH+](C)Cc3ccco3)cc(=O)oc2cc1O |
| InChI | InChI=1S/C18H19NO4/c1-3-12-7-15-13(8-18(21)23-17(15)9-16(12)20)10-19(2)11-14-5-4-6-22-14/h4-9,20H,3,10-11H2,1-2H3/p+1 |
| InChIKey | VOQOHRYHLKVEPL-UHFFFAOYSA-O |
| XLogP | 1.87 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|