C17H16O4S — CID 78761685
6-ethyl-4-(furan-2-ylmethylsulfanylmethyl)-7-hydroxychromen-2-one (PubChem CID 78761685) has the molecular formula C17H16O4S and a molecular weight of 316.38 g/mol. Its IUPAC name is 6-ethyl-4-(furan-2-ylmethylsulfanylmethyl)-7-hydroxychromen-2-one.
| Compound Name | 6-ethyl-4-(furan-2-ylmethylsulfanylmethyl)-7-hydroxychromen-2-one |
|---|---|
| PubChem CID | 78761685 |
| Molecular Formula | C17H16O4S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 6-ethyl-4-(furan-2-ylmethylsulfanylmethyl)-7-hydroxychromen-2-one |
| SMILES | CCc1cc2c(CSCc3ccco3)cc(=O)oc2cc1O |
| InChI | InChI=1S/C17H16O4S/c1-2-11-6-14-12(9-22-10-13-4-3-5-20-13)7-17(19)21-16(14)8-15(11)18/h3-8,18H,2,9-10H2,1H3 |
| InChIKey | MJIQQKIOGPDYGG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|