C21H20NO3S+ — CID 9265900
2-(furan-2-ylmethylsulfanyl)ethyl-[(3-oxobenzo[f]chromen-1-yl)methyl]azanium (PubChem CID 9265900) has the molecular formula C21H20NO3S+ and a molecular weight of 366.46 g/mol. Its IUPAC name is 2-(furan-2-ylmethylsulfanyl)ethyl-[(3-oxobenzo[f]chromen-1-yl)methyl]azanium.
| Compound Name | 2-(furan-2-ylmethylsulfanyl)ethyl-[(3-oxobenzo[f]chromen-1-yl)methyl]azanium |
|---|---|
| PubChem CID | 9265900 |
| Molecular Formula | C21H20NO3S+ |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 2-(furan-2-ylmethylsulfanyl)ethyl-[(3-oxobenzo[f]chromen-1-yl)methyl]azanium |
| SMILES | O=c1cc(C[NH2+]CCSCc2ccco2)c2c(ccc3ccccc32)o1 |
| InChI | InChI=1S/C21H19NO3S/c23-20-12-16(13-22-9-11-26-14-17-5-3-10-24-17)21-18-6-2-1-4-15(18)7-8-19(21)25-20/h1-8,10,12,22H,9,11,13-14H2/p+1 |
| InChIKey | QFTLRRYDYZMJIM-UHFFFAOYSA-O |
| XLogP | 3.54 |
| TPSA | 59.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|