C19H22NO2+ — CID 9265625
(3-oxobenzo[f]chromen-1-yl)methyl-pentan-3-ylazanium (PubChem CID 9265625) has the molecular formula C19H22NO2+ and a molecular weight of 296.39 g/mol. Its IUPAC name is (3-oxobenzo[f]chromen-1-yl)methyl-pentan-3-ylazanium.
| Compound Name | (3-oxobenzo[f]chromen-1-yl)methyl-pentan-3-ylazanium |
|---|---|
| PubChem CID | 9265625 |
| Molecular Formula | C19H22NO2+ |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | (3-oxobenzo[f]chromen-1-yl)methyl-pentan-3-ylazanium |
| SMILES | CCC(CC)[NH2+]Cc1cc(=O)oc2ccc3ccccc3c12 |
| InChI | InChI=1S/C19H21NO2/c1-3-15(4-2)20-12-14-11-18(21)22-17-10-9-13-7-5-6-8-16(13)19(14)17/h5-11,15,20H,3-4,12H2,1-2H3/p+1 |
| InChIKey | CKQTXVXYMKSECZ-UHFFFAOYSA-O |
| XLogP | 3.20 |
| TPSA | 46.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|