C17H17N2O3+ — CID 8772091
[2-(methylamino)-2-oxoethyl]-[(3-oxobenzo[f]chromen-1-yl)methyl]azanium (PubChem CID 8772091) has the molecular formula C17H17N2O3+ and a molecular weight of 297.33 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl]-[(3-oxobenzo[f]chromen-1-yl)methyl]azanium.
| Compound Name | [2-(methylamino)-2-oxoethyl]-[(3-oxobenzo[f]chromen-1-yl)methyl]azanium |
|---|---|
| PubChem CID | 8772091 |
| Molecular Formula | C17H17N2O3+ |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl]-[(3-oxobenzo[f]chromen-1-yl)methyl]azanium |
| SMILES | CNC(=O)C[NH2+]Cc1cc(=O)oc2ccc3ccccc3c12 |
| InChI | InChI=1S/C17H16N2O3/c1-18-15(20)10-19-9-12-8-16(21)22-14-7-6-11-4-2-3-5-13(11)17(12)14/h2-8,19H,9-10H2,1H3,(H,18,20)/p+1 |
| InChIKey | QVAQAXRUMFVBPB-UHFFFAOYSA-O |
| XLogP | 0.76 |
| TPSA | 75.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|