C19H19NO4 — CID 9262893
methyl 4-[(3-oxobenzo[f]chromen-1-yl)methylamino]butanoate (PubChem CID 9262893) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is methyl 4-[(3-oxobenzo[f]chromen-1-yl)methylamino]butanoate.
| Compound Name | methyl 4-[(3-oxobenzo[f]chromen-1-yl)methylamino]butanoate |
|---|---|
| PubChem CID | 9262893 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | methyl 4-[(3-oxobenzo[f]chromen-1-yl)methylamino]butanoate |
| SMILES | COC(=O)CCCNCc1cc(=O)oc2ccc3ccccc3c12 |
| InChI | InChI=1S/C19H19NO4/c1-23-17(21)7-4-10-20-12-14-11-18(22)24-16-9-8-13-5-2-3-6-15(13)19(14)16/h2-3,5-6,8-9,11,20H,4,7,10,12H2,1H3 |
| InChIKey | HRVXPOUWABBHBY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|