C21H26N2O2 — CID 9262898
1-[[3-(tert-butylamino)propylamino]methyl]benzo[f]chromen-3-one (PubChem CID 9262898) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 1-[[3-(tert-butylamino)propylamino]methyl]benzo[f]chromen-3-one.
| Compound Name | 1-[[3-(tert-butylamino)propylamino]methyl]benzo[f]chromen-3-one |
|---|---|
| PubChem CID | 9262898 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 1-[[3-(tert-butylamino)propylamino]methyl]benzo[f]chromen-3-one |
| SMILES | CC(C)(C)NCCCNCc1cc(=O)oc2ccc3ccccc3c12 |
| InChI | InChI=1S/C21H26N2O2/c1-21(2,3)23-12-6-11-22-14-16-13-19(24)25-18-10-9-15-7-4-5-8-17(15)20(16)18/h4-5,7-10,13,22-23H,6,11-12,14H2,1-3H3 |
| InChIKey | IWYGIKIHPBUHEC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|