C24H24NO4+ — CID 9256464
2-(3,4-dimethoxyphenyl)ethyl-[(3-oxobenzo[f]chromen-1-yl)methyl]azanium (PubChem CID 9256464) has the molecular formula C24H24NO4+ and a molecular weight of 390.46 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)ethyl-[(3-oxobenzo[f]chromen-1-yl)methyl]azanium.
| Compound Name | 2-(3,4-dimethoxyphenyl)ethyl-[(3-oxobenzo[f]chromen-1-yl)methyl]azanium |
|---|---|
| PubChem CID | 9256464 |
| Molecular Formula | C24H24NO4+ |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)ethyl-[(3-oxobenzo[f]chromen-1-yl)methyl]azanium |
| SMILES | COc1ccc(CC[NH2+]Cc2cc(=O)oc3ccc4ccccc4c23)cc1OC |
| InChI | InChI=1S/C24H23NO4/c1-27-20-9-7-16(13-22(20)28-2)11-12-25-15-18-14-23(26)29-21-10-8-17-5-3-4-6-19(17)24(18)21/h3-10,13-14,25H,11-12,15H2,1-2H3/p+1 |
| InChIKey | PCJXNRAQFUPILU-UHFFFAOYSA-O |
| XLogP | 3.27 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|