C25H28N2O3+2 — CID 9263009
[(1S)-1-(3-methoxyphenyl)-2-[(3-oxobenzo[f]chromen-1-yl)methylazaniumyl]ethyl]-dimethylazanium (PubChem CID 9263009) has the molecular formula C25H28N2O3+2 and a molecular weight of 404.51 g/mol. Its IUPAC name is [(1S)-1-(3-methoxyphenyl)-2-[(3-oxobenzo[f]chromen-1-yl)methylazaniumyl]ethyl]-dimethylazanium.
| Compound Name | [(1S)-1-(3-methoxyphenyl)-2-[(3-oxobenzo[f]chromen-1-yl)methylazaniumyl]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 9263009 |
| Molecular Formula | C25H28N2O3+2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | [(1S)-1-(3-methoxyphenyl)-2-[(3-oxobenzo[f]chromen-1-yl)methylazaniumyl]ethyl]-dimethylazanium |
| SMILES | COc1cccc([C@@H](C[NH2+]Cc2cc(=O)oc3ccc4ccccc4c23)[NH+](C)C)c1 |
| InChI | InChI=1S/C25H26N2O3/c1-27(2)22(18-8-6-9-20(13-18)29-3)16-26-15-19-14-24(28)30-23-12-11-17-7-4-5-10-21(17)25(19)23/h4-14,22,26H,15-16H2,1-3H3/p+2/t22-/m1/s1 |
| InChIKey | FUVAQEUYJJRBBW-JOCHJYFZSA-P |
| XLogP | 1.90 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|