C21H25ClN2O2+2 — CID 9256697
[(1R)-2-[(6-chloro-7-methyl-2-oxochromen-4-yl)methylazaniumyl]-1-phenylethyl]-dimethylazanium (PubChem CID 9256697) has the molecular formula C21H25ClN2O2+2 and a molecular weight of 372.90 g/mol. Its IUPAC name is [(1R)-2-[(6-chloro-7-methyl-2-oxochromen-4-yl)methylazaniumyl]-1-phenylethyl]-dimethylazanium.
| Compound Name | [(1R)-2-[(6-chloro-7-methyl-2-oxochromen-4-yl)methylazaniumyl]-1-phenylethyl]-dimethylazanium |
|---|---|
| PubChem CID | 9256697 |
| Molecular Formula | C21H25ClN2O2+2 |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | [(1R)-2-[(6-chloro-7-methyl-2-oxochromen-4-yl)methylazaniumyl]-1-phenylethyl]-dimethylazanium |
| SMILES | Cc1cc2oc(=O)cc(C[NH2+]C[C@@H](c3ccccc3)[NH+](C)C)c2cc1Cl |
| InChI | InChI=1S/C21H23ClN2O2/c1-14-9-20-17(11-18(14)22)16(10-21(25)26-20)12-23-13-19(24(2)3)15-7-5-4-6-8-15/h4-11,19,23H,12-13H2,1-3H3/p+2/t19-/m0/s1 |
| InChIKey | LYDPFQMYJAFURY-IBGZPJMESA-P |
| XLogP | 1.70 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|