C20H26N2O3+2 — CID 9255953
[(1S)-2-[(7-ethyl-2-oxochromen-4-yl)methylazaniumyl]-1-(furan-2-yl)ethyl]-dimethylazanium (PubChem CID 9255953) has the molecular formula C20H26N2O3+2 and a molecular weight of 342.44 g/mol. Its IUPAC name is [(1S)-2-[(7-ethyl-2-oxochromen-4-yl)methylazaniumyl]-1-(furan-2-yl)ethyl]-dimethylazanium.
| Compound Name | [(1S)-2-[(7-ethyl-2-oxochromen-4-yl)methylazaniumyl]-1-(furan-2-yl)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 9255953 |
| Molecular Formula | C20H26N2O3+2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | [(1S)-2-[(7-ethyl-2-oxochromen-4-yl)methylazaniumyl]-1-(furan-2-yl)ethyl]-dimethylazanium |
| SMILES | CCc1ccc2c(C[NH2+]C[C@@H](c3ccco3)[NH+](C)C)cc(=O)oc2c1 |
| InChI | InChI=1S/C20H24N2O3/c1-4-14-7-8-16-15(11-20(23)25-19(16)10-14)12-21-13-17(22(2)3)18-6-5-9-24-18/h5-11,17,21H,4,12-13H2,1-3H3/p+2/t17-/m0/s1 |
| InChIKey | PQKWTNVXVOHALD-KRWDZBQOSA-P |
| XLogP | 0.90 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|