C25H32N2O3+2 — CID 9256874
(7-ethyl-2-oxochromen-4-yl)methyl-[(2R)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ium-1-ylethyl]azanium (PubChem CID 9256874) has the molecular formula C25H32N2O3+2 and a molecular weight of 408.54 g/mol. Its IUPAC name is (7-ethyl-2-oxochromen-4-yl)methyl-[(2R)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ium-1-ylethyl]azanium.
| Compound Name | (7-ethyl-2-oxochromen-4-yl)methyl-[(2R)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ium-1-ylethyl]azanium |
|---|---|
| PubChem CID | 9256874 |
| Molecular Formula | C25H32N2O3+2 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | (7-ethyl-2-oxochromen-4-yl)methyl-[(2R)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ium-1-ylethyl]azanium |
| SMILES | CCc1ccc2c(C[NH2+]C[C@@H](c3ccc(OC)cc3)[NH+]3CCCC3)cc(=O)oc2c1 |
| InChI | InChI=1S/C25H30N2O3/c1-3-18-6-11-22-20(15-25(28)30-24(22)14-18)16-26-17-23(27-12-4-5-13-27)19-7-9-21(29-2)10-8-19/h6-11,14-15,23,26H,3-5,12-13,16-17H2,1-2H3/p+2/t23-/m0/s1 |
| InChIKey | QPBFORHWCLVZCS-QHCPKHFHSA-P |
| XLogP | 1.85 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|