C24H28NO4+ — CID 8833090
4-[[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-7-ethylchromen-2-one (PubChem CID 8833090) has the molecular formula C24H28NO4+ and a molecular weight of 394.49 g/mol. Its IUPAC name is 4-[[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-7-ethylchromen-2-one.
| Compound Name | 4-[[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-7-ethylchromen-2-one |
|---|---|
| PubChem CID | 8833090 |
| Molecular Formula | C24H28NO4+ |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 4-[[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-7-ethylchromen-2-one |
| SMILES | CCc1ccc2c(C[NH+]3CCC[C@H]3c3cc(OC)ccc3OC)cc(=O)oc2c1 |
| InChI | InChI=1S/C24H27NO4/c1-4-16-7-9-19-17(13-24(26)29-23(19)12-16)15-25-11-5-6-21(25)20-14-18(27-2)8-10-22(20)28-3/h7-10,12-14,21H,4-6,11,15H2,1-3H3/p+1/t21-/m0/s1 |
| InChIKey | JOXPIAOAWKRIJZ-NRFANRHFSA-O |
| XLogP | 3.29 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|