C22H24NO5+ — CID 8854927
4-[[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-7-hydroxychromen-2-one (PubChem CID 8854927) has the molecular formula C22H24NO5+ and a molecular weight of 382.44 g/mol. Its IUPAC name is 4-[[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-7-hydroxychromen-2-one.
| Compound Name | 4-[[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-7-hydroxychromen-2-one |
|---|---|
| PubChem CID | 8854927 |
| Molecular Formula | C22H24NO5+ |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 4-[[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-7-hydroxychromen-2-one |
| SMILES | COc1ccc([C@H]2CCC[NH+]2Cc2cc(=O)oc3cc(O)ccc23)c(OC)c1 |
| InChI | InChI=1S/C22H23NO5/c1-26-16-6-8-18(20(12-16)27-2)19-4-3-9-23(19)13-14-10-22(25)28-21-11-15(24)5-7-17(14)21/h5-8,10-12,19,24H,3-4,9,13H2,1-2H3/p+1/t19-/m1/s1 |
| InChIKey | XPHLTWFXEZZAJB-LJQANCHMSA-O |
| XLogP | 2.44 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|