C17H24N2O3+2 — CID 8749929
(7-methoxy-2-oxochromen-4-yl)methyl-(2-pyrrolidin-1-ium-1-ylethyl)azanium (PubChem CID 8749929) has the molecular formula C17H24N2O3+2 and a molecular weight of 304.39 g/mol. Its IUPAC name is (7-methoxy-2-oxochromen-4-yl)methyl-(2-pyrrolidin-1-ium-1-ylethyl)azanium.
| Compound Name | (7-methoxy-2-oxochromen-4-yl)methyl-(2-pyrrolidin-1-ium-1-ylethyl)azanium |
|---|---|
| PubChem CID | 8749929 |
| Molecular Formula | C17H24N2O3+2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | (7-methoxy-2-oxochromen-4-yl)methyl-(2-pyrrolidin-1-ium-1-ylethyl)azanium |
| SMILES | COc1ccc2c(C[NH2+]CC[NH+]3CCCC3)cc(=O)oc2c1 |
| InChI | InChI=1S/C17H22N2O3/c1-21-14-4-5-15-13(10-17(20)22-16(15)11-14)12-18-6-9-19-7-2-3-8-19/h4-5,10-11,18H,2-3,6-9,12H2,1H3/p+2 |
| InChIKey | FNBPIJCMLQAIRS-UHFFFAOYSA-P |
| XLogP | -0.46 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|