C19H26NO2+ — CID 9265963
cycloheptyl-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]azanium (PubChem CID 9265963) has the molecular formula C19H26NO2+ and a molecular weight of 300.42 g/mol. Its IUPAC name is cycloheptyl-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]azanium.
| Compound Name | cycloheptyl-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]azanium |
|---|---|
| PubChem CID | 9265963 |
| Molecular Formula | C19H26NO2+ |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | cycloheptyl-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]azanium |
| SMILES | Cc1cc2oc(=O)cc(C[NH2+]C3CCCCCC3)c2cc1C |
| InChI | InChI=1S/C19H25NO2/c1-13-9-17-15(11-19(21)22-18(17)10-14(13)2)12-20-16-7-5-3-4-6-8-16/h9-11,16,20H,3-8,12H2,1-2H3/p+1 |
| InChIKey | UJUFJLJNRZTBAR-UHFFFAOYSA-O |
| XLogP | 3.20 |
| TPSA | 46.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|