C23H25NO2 — CID 9260416
6,7-dimethyl-4-[[methyl-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]methyl]chromen-2-one (PubChem CID 9260416) has the molecular formula C23H25NO2 and a molecular weight of 347.46 g/mol. Its IUPAC name is 6,7-dimethyl-4-[[methyl-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]methyl]chromen-2-one.
| Compound Name | 6,7-dimethyl-4-[[methyl-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]methyl]chromen-2-one |
|---|---|
| PubChem CID | 9260416 |
| Molecular Formula | C23H25NO2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 6,7-dimethyl-4-[[methyl-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]methyl]chromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CN(C)[C@H]3CCCc4ccccc43)c2cc1C |
| InChI | InChI=1S/C23H25NO2/c1-15-11-20-18(13-23(25)26-22(20)12-16(15)2)14-24(3)21-10-6-8-17-7-4-5-9-19(17)21/h4-5,7,9,11-13,21H,6,8,10,14H2,1-3H3/t21-/m0/s1 |
| InChIKey | CJIWPGFHMAPSDC-NRFANRHFSA-N |
| XLogP | 4.92 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|