C23H26NO2+ — CID 9260409
(7,8-dimethyl-2-oxochromen-4-yl)methyl-methyl-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]azanium (PubChem CID 9260409) has the molecular formula C23H26NO2+ and a molecular weight of 348.47 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl-methyl-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]azanium.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl-methyl-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]azanium |
|---|---|
| PubChem CID | 9260409 |
| Molecular Formula | C23H26NO2+ |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl-methyl-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]azanium |
| SMILES | Cc1ccc2c(C[NH+](C)[C@H]3CCCc4ccccc43)cc(=O)oc2c1C |
| InChI | InChI=1S/C23H25NO2/c1-15-11-12-20-18(13-22(25)26-23(20)16(15)2)14-24(3)21-10-6-8-17-7-4-5-9-19(17)21/h4-5,7,9,11-13,21H,6,8,10,14H2,1-3H3/p+1/t21-/m0/s1 |
| InChIKey | GBYUXUQGCBDOGN-NRFANRHFSA-O |
| XLogP | 3.50 |
| TPSA | 34.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|