C24H26NO3+ — CID 7732356
6-ethyl-10-methyl-3-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-3,4-dihydro-2H-pyrano[3,2-g][1,3]benzoxazin-3-ium-8-one (PubChem CID 7732356) has the molecular formula C24H26NO3+ and a molecular weight of 376.48 g/mol. Its IUPAC name is 6-ethyl-10-methyl-3-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-3,4-dihydro-2H-pyrano[3,2-g][1,3]benzoxazin-3-ium-8-one.
| Compound Name | 6-ethyl-10-methyl-3-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-3,4-dihydro-2H-pyrano[3,2-g][1,3]benzoxazin-3-ium-8-one |
|---|---|
| PubChem CID | 7732356 |
| Molecular Formula | C24H26NO3+ |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 6-ethyl-10-methyl-3-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-3,4-dihydro-2H-pyrano[3,2-g][1,3]benzoxazin-3-ium-8-one |
| SMILES | CCc1cc(=O)oc2c(C)c3c(cc12)C[NH+]([C@@H]1CCCc2ccccc21)CO3 |
| InChI | InChI=1S/C24H25NO3/c1-3-16-12-22(26)28-24-15(2)23-18(11-20(16)24)13-25(14-27-23)21-10-6-8-17-7-4-5-9-19(17)21/h4-5,7,9,11-12,21H,3,6,8,10,13-14H2,1-2H3/p+1/t21-/m1/s1 |
| InChIKey | YPDPONXPYQDVCG-OAQYLSRUSA-O |
| XLogP | 3.48 |
| TPSA | 43.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|