C23H23NO4 — CID 7679113
10-methyl-3-[[(2S)-oxolan-2-yl]methyl]-6-phenyl-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-8-one (PubChem CID 7679113) has the molecular formula C23H23NO4 and a molecular weight of 377.44 g/mol. Its IUPAC name is 10-methyl-3-[[(2S)-oxolan-2-yl]methyl]-6-phenyl-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-8-one.
| Compound Name | 10-methyl-3-[[(2S)-oxolan-2-yl]methyl]-6-phenyl-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-8-one |
|---|---|
| PubChem CID | 7679113 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 10-methyl-3-[[(2S)-oxolan-2-yl]methyl]-6-phenyl-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-8-one |
| SMILES | Cc1c2c(cc3c(-c4ccccc4)cc(=O)oc13)CN(C[C@@H]1CCCO1)CO2 |
| InChI | InChI=1S/C23H23NO4/c1-15-22-17(12-24(14-27-22)13-18-8-5-9-26-18)10-20-19(11-21(25)28-23(15)20)16-6-3-2-4-7-16/h2-4,6-7,10-11,18H,5,8-9,12-14H2,1H3/t18-/m0/s1 |
| InChIKey | HAOPRZGAXWATAK-SFHVURJKSA-N |
| XLogP | 4.10 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|