C22H23NO5 — CID 110276074
(7Z)-9-methyl-7-[(5-methylfuran-2-yl)methylidene]-3-(oxolan-2-ylmethyl)-2,4-dihydrofuro[3,2-g][1,3]benzoxazin-6-one (PubChem CID 110276074) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is (7Z)-9-methyl-7-[(5-methylfuran-2-yl)methylidene]-3-(oxolan-2-ylmethyl)-2,4-dihydrofuro[3,2-g][1,3]benzoxazin-6-one.
| Compound Name | (7Z)-9-methyl-7-[(5-methylfuran-2-yl)methylidene]-3-(oxolan-2-ylmethyl)-2,4-dihydrofuro[3,2-g][1,3]benzoxazin-6-one |
|---|---|
| PubChem CID | 110276074 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | (7Z)-9-methyl-7-[(5-methylfuran-2-yl)methylidene]-3-(oxolan-2-ylmethyl)-2,4-dihydrofuro[3,2-g][1,3]benzoxazin-6-one |
| SMILES | Cc1ccc(/C=C2\Oc3c(cc4c(c3C)OCN(CC3CCCO3)C4)C2=O)o1 |
| InChI | InChI=1S/C22H23NO5/c1-13-5-6-16(27-13)9-19-20(24)18-8-15-10-23(11-17-4-3-7-25-17)12-26-21(15)14(2)22(18)28-19/h5-6,8-9,17H,3-4,7,10-12H2,1-2H3/b19-9- |
| InChIKey | UWVXMQXRGDPBJD-OCKHKDLRSA-N |
| XLogP | 3.84 |
| TPSA | 61.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_I(6)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|