C18H20 — CID 23310853
1-(2-ethylphenyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 23310853) has the molecular formula C18H20 and a molecular weight of 236.36 g/mol. Its IUPAC name is 1-(2-ethylphenyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-(2-ethylphenyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 23310853 |
| Molecular Formula | C18H20 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 1-(2-ethylphenyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCc1ccccc1C1CCCc2ccccc21 |
| InChI | InChI=1S/C18H20/c1-2-14-8-3-5-11-16(14)18-13-7-10-15-9-4-6-12-17(15)18/h3-6,8-9,11-12,18H,2,7,10,13H2,1H3 |
| InChIKey | KSNXYMDJSSSBRF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |