C16H18N2 — CID 19849908
4-(1,2,3,4-tetrahydronaphthalen-1-yl)benzene-1,3-diamine (PubChem CID 19849908) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 4-(1,2,3,4-tetrahydronaphthalen-1-yl)benzene-1,3-diamine.
| Compound Name | 4-(1,2,3,4-tetrahydronaphthalen-1-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 19849908 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 4-(1,2,3,4-tetrahydronaphthalen-1-yl)benzene-1,3-diamine |
| SMILES | Nc1ccc(C2CCCc3ccccc32)c(N)c1 |
| InChI | InChI=1S/C16H18N2/c17-12-8-9-15(16(18)10-12)14-7-3-5-11-4-1-2-6-13(11)14/h1-2,4,6,8-10,14H,3,5,7,17-18H2 |
| InChIKey | YIXANLYFFVROFE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|