C16H15Br — CID 22613084
1-(3-bromophenyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 22613084) has the molecular formula C16H15Br and a molecular weight of 287.20 g/mol. Its IUPAC name is 1-(3-bromophenyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-(3-bromophenyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 22613084 |
| Molecular Formula | C16H15Br |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 1-(3-bromophenyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | Brc1cccc(C2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C16H15Br/c17-14-8-3-7-13(11-14)16-10-4-6-12-5-1-2-9-15(12)16/h1-3,5,7-9,11,16H,4,6,10H2 |
| InChIKey | SKKBSVAKQRPNOL-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |