C18H18 — CID 173404050
1-(2,3-dihydro-1H-inden-5-yl)-2,3-dihydro-1H-indene (PubChem CID 173404050) has the molecular formula C18H18 and a molecular weight of 234.34 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2,3-dihydro-1H-indene.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 173404050 |
| Molecular Formula | C18H18 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2,3-dihydro-1H-indene |
| SMILES | c1ccc2c(c1)CCC2c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C18H18/c1-2-7-17-14(4-1)10-11-18(17)16-9-8-13-5-3-6-15(13)12-16/h1-2,4,7-9,12,18H,3,5-6,10-11H2 |
| InChIKey | BGZKTAGAGVTAHZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |