About 2-[(1R)-2,3-dihydro-1H-inden-1-yl]naphthalene;methoxymethane
2-[(1R)-2,3-dihydro-1H-inden-1-yl]naphthalene;methoxymethane (PubChem CID 142137917) has the molecular formula C21H22O
and a molecular weight of 290.41 g/mol. Its IUPAC name is 2-[(1R)-2,3-dihydro-1H-inden-1-yl]naphthalene;methoxymethane.
Molecular Properties
| Compound Name | 2-[(1R)-2,3-dihydro-1H-inden-1-yl]naphthalene;methoxymethane |
| PubChem CID | 142137917 |
| Molecular Formula | C21H22O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 2-[(1R)-2,3-dihydro-1H-inden-1-yl]naphthalene;methoxymethane |
| SMILES | COC.c1ccc2c(c1)CC[C@@H]2c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H16.C2H6O/c1-2-7-16-13-17(10-9-14(16)5-1)19-12-11-15-6-3-4-8-18(15)19;1-3-2/h1-10,13,19H,11-12H2;1-2H3/t19-;/m1./s1 |
| InChIKey | VMSQBKHWSVFMMF-FSRHSHDFSA-N |
| XLogP | 5.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(1R)-2,3-dihydro-1H-inden-1-yl]naphthalene;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R)-2,3-dihydro-1H-inden-1-yl]naphthalene;methoxymethane?
The IUPAC name of 2-[(1R)-2,3-dihydro-1H-inden-1-yl]naphthalene;methoxymethane (CID 142137917) is 2-[(1R)-2,3-dihydro-1H-inden-1-yl]naphthalene;methoxymethane.
What is the SMILES notation for 2-[(1R)-2,3-dihydro-1H-inden-1-yl]naphthalene;methoxymethane?
The canonical SMILES for 2-[(1R)-2,3-dihydro-1H-inden-1-yl]naphthalene;methoxymethane is COC.c1ccc2c(c1)CC[C@@H]2c1ccc2ccccc2c1.
What is the InChIKey of 2-[(1R)-2,3-dihydro-1H-inden-1-yl]naphthalene;methoxymethane?
The InChIKey is VMSQBKHWSVFMMF-FSRHSHDFSA-N. The full InChI is InChI=1S/C19H16.C2H6O/c1-2-7-16-13-17(10-9-14(16)5-1)19-12-11-15-6-3-4-8-18(15)19;1-3-2/h1-10,13,19H,11-12H2;1-2H3/t19-;/m1./s1.
What are the key properties of 2-[(1R)-2,3-dihydro-1H-inden-1-yl]naphthalene;methoxymethane?
2-[(1R)-2,3-dihydro-1H-inden-1-yl]naphthalene;methoxymethane has a molecular weight of 290.41 g/mol, XLogP of 5.18, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R)-2,3-dihydro-1H-inden-1-yl]naphthalene;methoxymethane is sourced from PubChem (CID 142137917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).