C21H22O — CID 142137917
2-[(1R)-2,3-dihydro-1H-inden-1-yl]naphthalene;methoxymethane (PubChem CID 142137917) has the molecular formula C21H22O and a molecular weight of 290.41 g/mol. Its IUPAC name is 2-[(1R)-2,3-dihydro-1H-inden-1-yl]naphthalene;methoxymethane.
| Compound Name | 2-[(1R)-2,3-dihydro-1H-inden-1-yl]naphthalene;methoxymethane |
|---|---|
| PubChem CID | 142137917 |
| Molecular Formula | C21H22O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 2-[(1R)-2,3-dihydro-1H-inden-1-yl]naphthalene;methoxymethane |
| SMILES | COC.c1ccc2c(c1)CC[C@@H]2c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H16.C2H6O/c1-2-7-16-13-17(10-9-14(16)5-1)19-12-11-15-6-3-4-8-18(15)19;1-3-2/h1-10,13,19H,11-12H2;1-2H3/t19-;/m1./s1 |
| InChIKey | VMSQBKHWSVFMMF-FSRHSHDFSA-N |
| XLogP | 5.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |